Preferred Name |
phosphonic acid |
|
Synonyms |
Phosphonic acid hydridodihydroxidooxidophosphorus hydridotrioxophosphoric(2-) acid phosphonic acid dihydrogen hydridotrioxophosphate(2-) Phosphonsaeure Phosphonate (HO)2HPO H2PHO3 H3PO3 HPO(OH)2 Phosphite [PHO(OH)2] |
|
Definitions |
A phosphorus oxoacid that consists of a single pentavalent phosphorus covalently bound via single bonds to a single hydrogen and two hydroxy groups and via a double bond to an oxygen. The parent of the class of phosphonic acids. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_44976 |
|
charge |
0 |
|
database_cross_reference |
KEGG:C06701 Reaxys:1209272 Gmelin:1619 Wikipedia:Phosphonic_acid CAS:13598-36-2 PDBeChem:PHS |
|
definition |
A phosphorus oxoacid that consists of a single pentavalent phosphorus covalently bound via single bonds to a single hydrogen and two hydroxy groups and via a double bond to an oxygen. The parent of the class of phosphonic acids. |
|
formula |
H3O3P |
|
has role | ||
has_alternative_id |
CHEBI:26067 |
|
has_exact_synonym |
Phosphonic acid hydridodihydroxidooxidophosphorus hydridotrioxophosphoric(2-) acid phosphonic acid dihydrogen hydridotrioxophosphate(2-) |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Phosphonsaeure Phosphonate (HO)2HPO H2PHO3 H3PO3 HPO(OH)2 Phosphite [PHO(OH)2] |
|
has_RxCUI |
1427087 |
|
id |
CHEBI:44976 |
|
in_subset | ||
inchi |
InChI=1S/H3O3P/c1-4(2)3/h4H,(H2,1,2,3) |
|
inchikey |
ABLZXFCXXLZCGV-UHFFFAOYSA-N |
|
is conjugate acid of | ||
is tautomer of | ||
label |
phosphonic acid |
|
mass |
81.99580 |
|
monoisotopicmass |
81.98198 |
|
notation |
CHEBI:44976 |
|
prefLabel |
phosphonic acid |
|
smiles |
OP(O)=O |
|
subClassOf |