loading...| Preferred Name |
guanabenz |
|
| Synonyms |
2-{[(2,6-dichlorophenyl)methylidene]amino}guanidine C8H8Cl2N4 |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB00629 |
|
| activates | ||
| binds | ||
| CASRN |
5051-62-7 |
|
| DBBrand |
guanabenz(usan) guanabenzo [inn-spanish] wy 8678 base gbz guanabenz acetate guanabenz [usan:inn] wytensin guanabenzum [inn-latin] |
|
| Definition |
An alpha-2 selective adrenergic agonist used as an antihypertensive agent. [PubChem] |
|
| has pharmacological target | ||
| InChI |
InChI=1S/C8H8Cl2N4/c9-6-2-1-3-7(10)5(6)4-13-14-8(11)12/h1-4H,(H4,11,12,14)/b13-4+ |
|
| InChIKey |
InChIKey=WDZVGELJXXEGPV-YIXHJXPBSA-N |
|
| is metabolised by | ||
| is substrate of | ||
| label |
guanabenz |
|
| may interact with |
http://purl.obolibrary.org/obo/dinto_DB00726 |
|
| modulates | ||
| prefixIRI |
obo2:dinto_DB00629 |
|
| prefLabel |
guanabenz |
|
| SMILES |
NC(N)=NN=CC1=C(Cl)C=CC=C1Cl |
|
| Synonym |
2-{[(2,6-dichlorophenyl)methylidene]amino}guanidine C8H8Cl2N4 |
|
| xref |
Drugs.com:http://www.drugs.com/cdi/guanabenz.html Wikipedia:http://en.wikipedia.org/wiki/Guanabenz PDRhealth:http://www.pdrhealth.com/drug_info/rxdrugprofiles/drugs/gua1612.shtml PharmGKB:PA164774903 PubChem Compound:5702063 PubChem Substance:46505200 ChemSpider:3397 |
|
| subClassOf |