loading...| Preferred Name |
carbimazole |
|
| Synonyms |
Ethyl 3-methyl-2-thioimidazoline-1-carboxylate ethyl 3-methyl-2-thioxo-2,3-dihydro-1H-imidazole-1-carboxylate ethyl 3-methyl-2-sulfanylidene-2,3-dihydro-1H-imidazole-1-carboxylate Carbinazole C7H10N2O2S Thyrostat carbimazole carbimazolum Carbethoxymethimazole carbimazol Athyromazole |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_617099 |
|
| altId |
CHEBI:3397 |
|
| ATCCode |
H03BB01 |
|
| binds | ||
| CASRN |
22232-54-8 |
|
| DBBrand |
atirozidina neo-thyreostat mertiran neo-mercazole tyrazol basolest carbotiroid neomercazole carbimazol spofa neo-tireol cg1 |
|
| DBname |
carbimazole |
|
| DBSynonym |
carbethoxymethimazole athyromazole carbimazol carbinazole carbimazolum [inn-latin] carbimazol [inn-spanish, french] |
|
| Definition |
A member of the class of imidazoles that is methimazole in which the nitrogen bearing a hydrogen is converted to its ethoxycarbonyl derivative. A prodrug for methimazol, carbimazole is used for the treatment of hyperthyroidism. |
|
| has pharmacological target | ||
| has role | ||
| InChI |
InChI=1S/C7H10N2O2S/c1-3-11-7(10)9-5-4-8(2)6(9)12/h4-5H,3H2,1-2H3 |
|
| InChIKey |
InChIKey=CFOYWRHIYXMDOT-UHFFFAOYSA-N |
|
| inhibits | ||
| label |
carbimazole |
|
| prefixIRI |
obo2:CHEBI_617099 |
|
| prefLabel |
carbimazole |
|
| SMILES |
CCOC(=O)N1C=CN(C)C1=S CCOC(=O)n1ccn(C)c1=S |
|
| Synonym |
Ethyl 3-methyl-2-thioimidazoline-1-carboxylate ethyl 3-methyl-2-thioxo-2,3-dihydro-1H-imidazole-1-carboxylate ethyl 3-methyl-2-sulfanylidene-2,3-dihydro-1H-imidazole-1-carboxylate Carbinazole C7H10N2O2S Thyrostat carbimazole carbimazolum Carbethoxymethimazole carbimazol Athyromazole |
|
| xref |
ChEMBL:18954039 Beilstein:0144339 Reaxys:144339 KEGG COMPOUND:C07615 Wikipedia:http://en.wikipedia.org/wiki/Carbimazole PharmGKB:PA164742970 DrugBank:DB00389 PubChem Substance:46506359 Patent:US2671088 Patent:US2815349 PubChem Compound:31072 NIST Chemistry WebBook:22232-54-8 KEGG DRUG:D07616 ChEBI:617099 CASRN:22232-54-8 CiteXplore:1502708 Wikipedia:Carbimazole ChemSpider:28829 |
|
| subClassOf |