Preferred Name |
valproate |
|
Synonyms |
C8H15O2 dipropylacetate 2-propylvalerate 2-propylpentanoate |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_60654 |
|
altId |
CHEBI:68615 |
|
Definition |
A branched-chain saturated fatty acid anion that is the conjugate base of valproic acid. |
|
has role | ||
InChI |
InChI=1S/C8H16O2/c1-3-5-7(6-4-2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10)/p-1 |
|
InChIKey |
InChIKey=NIJJYAXOARWZEE-UHFFFAOYSA-M |
|
label |
valproate |
|
prefixIRI |
obo2:CHEBI_60654 |
|
prefLabel |
valproate |
|
SMILES |
CCCC(CCC)C([O-])=O |
|
Synonym |
C8H15O2 dipropylacetate 2-propylvalerate 2-propylpentanoate |
|
xref |
CiteXplore:21454832 CiteXplore:21593515 CiteXplore:20633966 CiteXplore:21161183 CiteXplore:21243535 CiteXplore:21167688 CiteXplore:21629819 CiteXplore:21459656 CiteXplore:8681902 CiteXplore:21472635 CiteXplore:21767635 CiteXplore:16012283 |
|
subClassOf |
Create mapping