Preferred Name |
metformin |
|
Synonyms |
N,N-dimethylimidodicarbonimidic diamide Metformin 1,1-Dimethylbiguanide |
|
Definitions |
A member of the class of guanidines that is biguanide the carrying two methyl substituents at position 1. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_6801 |
|
alternative_term |
N,N-dimethylimidodicarbonimidic diamide Metformin |
|
charge |
0 |
|
database_cross_reference |
PMID:18608522 PMID:24428821 PMID:17062558 DrugBank:DB00331 Drug_Central:1725 Wikipedia:Metformin CAS:657-24-9 PMID:11772907 LINCS:LSM-4730 PMID:18212742 HMDB:HMDB0001921 KEGG:C07151 KEGG:D04966 Reaxys:606492 |
|
formula |
C4H11N5 |
|
fromArticle |
true |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
1,1-Dimethylbiguanide |
|
id |
CHEBI:6801 |
|
imported from | ||
in_subset | ||
inchi |
InChI=1S/C4H11N5/c1-9(2)4(7)8-3(5)6/h1-2H3,(H5,5,6,7,8) |
|
inchikey |
XZWYZXLIPXDOLR-UHFFFAOYSA-N |
|
label |
metformin |
|
mass |
129.16384 |
|
monoisotopicmass |
129.10145 |
|
notation |
CHEBI:6801 |
|
prefLabel |
metformin |
|
see also |
https://www.biorxiv.org/content/10.1101/2020.03.22.002386v3.full |
|
smiles |
CN(C)C(=N)NC(N)=N |
|
textual definition |
A member of the class of guanidines that is biguanide the carrying two methyl substituents at position 1. |
|
subClassOf |