loading...| Preferred Name |
imipramine |
|
| Synonyms |
3-(10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-amine Imipramine 3-(5H-DIBENZO[B,F]AZEPIN-5-YL)-N,N-DIMETHYLPROPAN-1-AMINE 10,11-dihydro-N,N-dimethyl-5H-dibenz[b,f]azepine-5-propanamine Melipramine N-(gamma-dimethylaminopropyl)iminodibenzyl 5-[3-(dimethylamino)propyl]-10,11-dihydro-5H-dibenz[b,f]azepine imipraminum Antideprin Imipramin Irmin imipramine imizine |
|
| Definitions |
A dibenzoazepine that is 5H-dibenzo[b,f]azepine substituted by a 3-(dimethylamino)propyl group at the nitrogen atom. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_47499 |
|
| charge |
0 |
|
| database_cross_reference |
Patent:US2554736 KEGG:C07049 Beilstein:256892 PMID:20825390 HMDB:HMDB0001848 DrugBank:DB00458 KEGG:D08070 LINCS:LSM-2852 Gmelin:1572523 Wikipedia:Imipramine CAS:50-49-7 Reaxys:256892 PDBeChem:IXX Drug_Central:1427 |
|
| formula |
C19H24N2 |
|
| has exact synonym |
3-(10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-amine Imipramine |
|
| has parent hydride | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_76779 |
|
| has_alternative_id |
CHEBI:47498 CHEBI:5881 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
3-(5H-DIBENZO[B,F]AZEPIN-5-YL)-N,N-DIMETHYLPROPAN-1-AMINE 10,11-dihydro-N,N-dimethyl-5H-dibenz[b,f]azepine-5-propanamine Melipramine N-(gamma-dimethylaminopropyl)iminodibenzyl 5-[3-(dimethylamino)propyl]-10,11-dihydro-5H-dibenz[b,f]azepine imipraminum Antideprin Imipramin Irmin imipramine imizine |
|
| id |
CHEBI:47499 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C19H24N2/c1-20(2)14-7-15-21-18-10-5-3-8-16(18)12-13-17-9-4-6-11-19(17)21/h3-6,8-11H,7,12-15H2,1-2H3 |
|
| inchikey |
BCGWQEUPMDMJNV-UHFFFAOYSA-N |
|
| label |
imipramine |
|
| mass |
280.40734 |
|
| monoisotopicmass |
280.19395 |
|
| notation |
CHEBI:47499 |
|
| prefLabel |
imipramine |
|
| smiles |
CN(C)CCCN1c2ccccc2CCc2ccccc12 |
|
| textual definition |
A dibenzoazepine that is 5H-dibenzo[b,f]azepine substituted by a 3-(dimethylamino)propyl group at the nitrogen atom. |
|
| subClassOf |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.