loading...| Preferred Name |
histidine |
|
| Synonyms |
2-amino-3-(1H-imidazol-4-yl)propanoic acid Histidine histidine alpha-Amino-1H-imidazole-4-propionic acid DL-Histidine Histidin histidina |
|
| Definitions |
An alpha-amino acid that is propanoic acid bearing an amino substituent at position 2 and a 1H-imidazol-4-yl group at position 3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_27570 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:4998-57-6 Gmelin:3656 KNApSAcK:C00001363 PMID:29286160 Reaxys:84087 PMID:17190852 PMID:22264337 KEGG:C00768 PMID:22770225 Beilstein:84087 Wikipedia:Histidine |
|
| formula |
C6H9N3O2 |
|
| has exact synonym |
2-amino-3-(1H-imidazol-4-yl)propanoic acid Histidine histidine |
|
| has part | ||
| has role | ||
| has_alternative_id |
CHEBI:43118 CHEBI:24598 CHEBI:5733 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
alpha-Amino-1H-imidazole-4-propionic acid DL-Histidine Histidin histidina |
|
| id |
CHEBI:27570 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C6H9N3O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1,7H2,(H,8,9)(H,10,11) |
|
| inchikey |
HNDVDQJCIGZPNO-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| label |
histidine |
|
| mass |
155.15468 |
|
| monoisotopicmass |
155.06948 |
|
| notation |
CHEBI:27570 |
|
| prefLabel |
histidine |
|
| smiles |
NC(Cc1c[nH]cn1)C(O)=O |
|
| textual definition |
An alpha-amino acid that is propanoic acid bearing an amino substituent at position 2 and a 1H-imidazol-4-yl group at position 3. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_33856 http://purl.obolibrary.org/obo/CHEBI_24780 |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.