loading...| Preferred Name |
lysine |
|
| Synonyms |
2,6-diaminohexanoic acid lysine alpha,epsilon-diaminocaproic acid K LYS Lysin |
|
| Definitions |
A diamino acid that is caproic (hexanoic) acid bearing two amino substituents at positions 2 and 6. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_25094 |
|
| charge |
0 |
|
| database_cross_reference |
Gmelin:279284 Wikipedia:Lysine CAS:70-54-2 KEGG:C16440 PMID:17439666 Reaxys:1616991 Beilstein:1616991 PMID:22264337 |
|
| formula |
C6H14N2O2 |
|
| has exact synonym |
2,6-diaminohexanoic acid lysine |
|
| has functional parent | ||
| has part | ||
| has role | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
alpha,epsilon-diaminocaproic acid K LYS Lysin |
|
| id |
CHEBI:25094 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10) |
|
| inchikey |
KDXKERNSBIXSRK-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| label |
lysine |
|
| mass |
146.18764 |
|
| monoisotopicmass |
146.10553 |
|
| notation |
CHEBI:25094 |
|
| prefLabel |
lysine |
|
| smiles |
NCCCCC(N)C(O)=O |
|
| textual definition |
A diamino acid that is caproic (hexanoic) acid bearing two amino substituents at positions 2 and 6. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_33704 |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.