loading...| Preferred Name |
L-lysine |
|
| Synonyms |
(2S)-2,6-diaminohexanoic acid L-Lysine L-lysine L-2,6-Diaminocaproic acid 6-ammonio-L-norleucine (S)-2,6-diaminohexanoic acid Lysine acid (S)-alpha,epsilon-diaminocaproic acid (S)-lysine K L-Lysin Lys lysina lysine lysinum |
|
| Definitions |
An L-alpha-amino acid; the L-isomer of lysine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_18019 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:8587651 HMDB:HMDB0000182 Gmelin:364182 PMID:24831709 MetaCyc:LYS PMID:17051348 CAS:56-87-1 Beilstein:1722531 PMID:24064214 Wikipedia:Lysine PMID:10930630 PMID:16901854 PMID:8070089 PMID:23325920 Drug_Central:1622 PMID:22575419 PMID:22064742 PMID:17979222 KEGG:C00047 PMID:22019452 PMID:23722415 PMID:23167968 YMDB:YMDB00330 PMID:22735334 KNApSAcK:C00001378 KEGG:D02304 PMID:25108762 Reaxys:1722531 DrugBank:DB00123 ECMDB:ECMDB00182 |
|
| formula |
C6H14N2O2 |
|
| has exact synonym |
(2S)-2,6-diaminohexanoic acid L-Lysine L-lysine |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_75772 http://purl.obolibrary.org/obo/CHEBI_77746 http://purl.obolibrary.org/obo/CHEBI_75771 http://purl.obolibrary.org/obo/CHEBI_27027 http://purl.obolibrary.org/obo/CHEBI_76971 http://purl.obolibrary.org/obo/CHEBI_35623 |
|
| has_alternative_id |
CHEBI:13135 CHEBI:43950 CHEBI:21351 CHEBI:6264 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
L-2,6-Diaminocaproic acid 6-ammonio-L-norleucine (S)-2,6-diaminohexanoic acid Lysine acid (S)-alpha,epsilon-diaminocaproic acid (S)-lysine K L-Lysin Lys lysina lysine lysinum |
|
| id |
CHEBI:18019 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10)/t5-/m0/s1 |
|
| inchikey |
KDXKERNSBIXSRK-YFKPBYRVSA-N |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| is enantiomer of | ||
| is tautomer of | ||
| label |
L-lysine |
|
| mass |
146.18764 |
|
| monoisotopicmass |
146.10553 |
|
| notation |
CHEBI:18019 |
|
| prefLabel |
L-lysine |
|
| smiles |
NCCCC[C@H](N)C(O)=O |
|
| textual definition |
An L-alpha-amino acid; the L-isomer of lysine. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_83813 http://purl.obolibrary.org/obo/CHEBI_25094 |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.