loading...| Preferred Name |
serine |
|
| Synonyms |
Serine serine 2-Amino-3-hydroxypropionic acid 3-Hydroxyalanine 2-amino-3-hydroxypropanoic acid Serin |
|
| Definitions |
An alpha-amino acid that is alanine substituted at position 3 by a hydroxy group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17822 |
|
| charge |
0 |
|
| database_cross_reference |
Beilstein:1721402 Wikipedia:Serine KEGG:C00716 Gmelin:26429 CAS:302-84-1 KNApSAcK:C00001393 Reaxys:1721402 |
|
| formula |
C3H7NO3 |
|
| has exact synonym |
Serine serine |
|
| has part | ||
| has role | ||
| has_alternative_id |
CHEBI:15081 CHEBI:26648 CHEBI:9116 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-Amino-3-hydroxypropionic acid 3-Hydroxyalanine 2-amino-3-hydroxypropanoic acid Serin |
|
| id |
CHEBI:17822 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7) |
|
| inchikey |
MTCFGRXMJLQNBG-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| is tautomer of | ||
| label |
serine |
|
| mass |
105.09262 |
|
| monoisotopicmass |
105.04259 |
|
| notation |
CHEBI:17822 |
|
| prefLabel |
serine |
|
| smiles |
NC(CO)C(O)=O |
|
| textual definition |
An alpha-amino acid that is alanine substituted at position 3 by a hydroxy group. |
|
| subClassOf |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.