loading...| Preferred Name |
valeric acid |
|
| Synonyms |
Valeric acid pentanoic acid Valeriansaeure n-Valeric acid propylacetic acid n-Pentanoate CH3-[CH2]3-COOH valeric acid, normal 1-butanecarboxylic acid n-pentanoic acid n-valeric acid Valerianic acid PENTANOIC ACID pentoic acid Pentanoic acid Pentanoate Valerate n-BuCOOH |
|
| Definitions |
A straight-chain saturated fatty acid containing five carbon atoms. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17418 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:109-52-4 PMID:20507156 DrugBank:DB02406 Gmelin:26714 PDBeChem:LEA Reaxys:969454 Beilstein:969454 HMDB:HMDB0000892 Wikipedia:Valeric_acid KEGG:C00803 LIPID_MAPS_instance:LMFA01010005 KNApSAcK:C00001208 PPDB:3130 |
|
| formula |
C5H10O2 |
|
| has exact synonym |
Valeric acid pentanoic acid |
|
| has role | ||
| has_alternative_id |
CHEBI:27263 CHEBI:27264 CHEBI:43606 CHEBI:113448 CHEBI:44803 CHEBI:7980 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Valeriansaeure n-Valeric acid propylacetic acid n-Pentanoate CH3-[CH2]3-COOH valeric acid, normal 1-butanecarboxylic acid n-pentanoic acid n-valeric acid Valerianic acid PENTANOIC ACID pentoic acid Pentanoic acid Pentanoate Valerate n-BuCOOH |
|
| id |
CHEBI:17418 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C5H10O2/c1-2-3-4-5(6)7/h2-4H2,1H3,(H,6,7) |
|
| inchikey |
NQPDZGIKBAWPEJ-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| label |
valeric acid |
|
| mass |
102.13170 |
|
| monoisotopicmass |
102.06808 |
|
| notation |
CHEBI:17418 |
|
| prefLabel |
valeric acid |
|
| smiles |
CCCCC(O)=O |
|
| textual definition |
A straight-chain saturated fatty acid containing five carbon atoms. |
|
| subClassOf |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.