loading...| Preferred Name |
L-phenylalanine |
|
| Synonyms |
(S)-alpha-Amino-beta-phenylpropionic acid beta-phenyl-L-alanine PHENYLALANINE 3-phenyl-L-alanine (S)-2-Amino-3-phenylpropionic acid F Phe L-phenylalanine (2S)-2-amino-3-phenylpropanoic acid L-Phenylalanine |
|
| Definitions |
The L-enantiomer of phenylalanine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17295 |
|
| alternative term |
(S)-alpha-Amino-beta-phenylpropionic acid beta-phenyl-L-alanine PHENYLALANINE 3-phenyl-L-alanine (S)-2-Amino-3-phenylpropionic acid F Phe L-phenylalanine (2S)-2-amino-3-phenylpropanoic acid L-Phenylalanine |
|
| charge |
0 |
|
| database_cross_reference |
PMID:16893175 PMID:24966042 Reaxys:1910408 DrugBank:DB00120 YMDB:YMDB00304 MetaCyc:PHE PMID:23836015 PMID:22081386 Gmelin:50837 PDBeChem:PHE KEGG:C00079 PMID:22209218 PMID:22112574 PMID:21203787 PMID:21956539 Drug_Central:2144 PMID:22143120 CAS:63-91-2 PMID:24733517 Wikipedia:Phenylalanine PMID:17784858 KEGG:D00021 HMDB:HMDB0000159 KNApSAcK:C00001386 ECMDB:ECMDB00159 PMID:24464217 Beilstein:1910408 PMID:13945318 PMID:22494897 |
|
| formula |
C9H11NO2 |
|
| has exact synonym |
L-phenylalanine (2S)-2-amino-3-phenylpropanoic acid L-Phenylalanine |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_75772 http://purl.obolibrary.org/obo/CHEBI_63332 http://purl.obolibrary.org/obo/CHEBI_75771 http://purl.obolibrary.org/obo/CHEBI_27027 http://purl.obolibrary.org/obo/CHEBI_76971 http://purl.obolibrary.org/obo/CHEBI_76967 |
|
| has_alternative_id |
CHEBI:44885 CHEBI:21370 CHEBI:44851 CHEBI:45079 CHEBI:13151 CHEBI:6282 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(S)-alpha-Amino-beta-phenylpropionic acid beta-phenyl-L-alanine PHENYLALANINE 3-phenyl-L-alanine (S)-2-Amino-3-phenylpropionic acid F Phe |
|
| id |
CHEBI:17295 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1 |
|
| inchikey |
COLNVLDHVKWLRT-QMMMGPOBSA-N |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| is enantiomer of | ||
| is tautomer of | ||
| label |
L-phenylalanine |
|
| mass |
165.18918 |
|
| monoisotopicmass |
165.07898 |
|
| notation |
CHEBI:17295 |
|
| prefLabel |
L-phenylalanine |
|
| smiles |
N[C@@H](Cc1ccccc1)C(O)=O |
|
| textual definition |
The L-enantiomer of phenylalanine. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_83813 http://purl.obolibrary.org/obo/CHEBI_15705 |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.