loading...| Preferred Name |
salicylic acid |
|
| Synonyms |
2-hydroxybenzoic acid Salicylic acid o-carboxyphenol 2-carboxyphenol o-hydroxybenzoic acid 2-HYDROXYBENZOIC ACID o-Hydroxybenzoic acid |
|
| Definitions |
A monohydroxybenzoic acid that is benzoic acid with a hydroxy group at the ortho position. It is obtained from the bark of the white willow and wintergreen leaves. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16914 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:12865403 LINCS:LSM-4763 PMID:1650428 HMDB:HMDB0001895 Reaxys:774890 PMID:29079364 PMID:19400653 KEGG:D00097 PMID:19816125 Wikipedia:Salicylic_Acid PMID:11016405 PMID:32807953 PDBeChem:SAL DrugBank:DB00936 CAS:69-72-7 Drug_Central:2416 MetaCyc:CPD-110 KNApSAcK:C00000206 PMID:3425858 PMID:22770225 KEGG:C00805 Gmelin:3418 Beilstein:774890 |
|
| formula |
C7H6O3 |
|
| has exact synonym |
2-hydroxybenzoic acid Salicylic acid |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_35441 http://purl.obolibrary.org/obo/CHEBI_37848 http://purl.obolibrary.org/obo/CHEBI_50176 http://purl.obolibrary.org/obo/CHEBI_73181 |
|
| has_alternative_id |
CHEBI:26597 CHEBI:45521 CHEBI:9006 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
o-carboxyphenol 2-carboxyphenol o-hydroxybenzoic acid 2-HYDROXYBENZOIC ACID o-Hydroxybenzoic acid |
|
| id |
CHEBI:16914 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C7H6O3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8H,(H,9,10) |
|
| inchikey |
YGSDEFSMJLZEOE-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| label |
salicylic acid |
|
| mass |
138.12070 |
|
| monoisotopicmass |
138.03169 |
|
| notation |
CHEBI:16914 |
|
| prefLabel |
salicylic acid |
|
| smiles |
OC(=O)c1ccccc1O |
|
| textual definition |
A monohydroxybenzoic acid that is benzoic acid with a hydroxy group at the ortho position. It is obtained from the bark of the white willow and wintergreen leaves. |
|
| subClassOf |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.