loading...| Preferred Name |
guanine |
|
| Synonyms |
2-amino-1,9-dihydro-6H-purin-6-one GUANINE Guanine guanine 2-Amino-6-hydroxypurine 2-amino-6-oxopurine G Gua |
|
| Definitions |
A 2-aminopurine carrying a 6-oxo substituent. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16235 |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:147911 KNApSAcK:C00001501 DrugBank:DB02377 PMID:8070089 Beilstein:147911 CAS:73-40-5 HMDB:HMDB0000132 PMID:22770225 PDBeChem:GUN Gmelin:431879 Wikipedia:Guanine KEGG:C00242 MetaCyc:GUANINE |
|
| formula |
C5H5N5O |
|
| has exact synonym |
2-amino-1,9-dihydro-6H-purin-6-one GUANINE Guanine guanine |
|
| has parent hydride | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_75772 http://purl.obolibrary.org/obo/CHEBI_77746 http://purl.obolibrary.org/obo/CHEBI_75771 |
|
| has_alternative_id |
CHEBI:42948 CHEBI:14372 CHEBI:14371 CHEBI:24443 CHEBI:5563 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-Amino-6-hydroxypurine 2-amino-6-oxopurine G Gua |
|
| id |
CHEBI:16235 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C5H5N5O/c6-5-9-3-2(4(11)10-5)7-1-8-3/h1H,(H4,6,7,8,9,10,11) |
|
| inchikey |
UYTPUPDQBNUYGX-UHFFFAOYSA-N |
|
| label |
guanine |
|
| mass |
151.126 |
|
| monoisotopicmass |
151.04941 |
|
| notation |
CHEBI:16235 |
|
| prefLabel |
guanine |
|
| smiles |
C12=C(N=C(NC1=O)N)NC=N2 |
|
| textual definition |
A 2-aminopurine carrying a 6-oxo substituent. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_26386 |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.