Preferred Name |
chlormezanone |
|
Synonyms |
2-(4-chlorophenyl)-3-methyl-1,3-thiazinan-4-one 1,1-dioxide chlormethazanone 2-(p-chlorophenyl)tetrahydro-3-methyl-4H-1,3-thiazin-4-one 1,1-dioxide chlormezanona (+-)-chlormezanone chlormezanonum 2-(p-chlorphenyl)-3-methyl-1,3-perhydrothiazin-4-on-1,1-dioxide chlormezanone |
|
Definitions |
A 1,3-thiazine that is 1,3-thiazinan-4-one S,S-dioxide in which a hydrogen at position 2 is substituted by a 4-chlorophenyl group and the hydrogen attached to the nitrogen is substituted by methyl. A non-benzodiazepine muscle relaxant, it was used in the management of anxiety and in the treatment of muscle spasms until being discontinued worldwide by its manufacturer in 1996, due to rare but serious cutaneous reactions. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3619 |
|
charge |
0 |
|
database_cross_reference |
PMID:3449070 PMID:15897685 DrugBank:DB01178 Patent:GB815203 PMID:10412893 PMID:9770210 Reaxys:23033 PMID:3720548 PMID:3768082 KEGG:D00268 LINCS:LSM-4356 PMID:6403110 PMID:7758315 PMID:10798243 Wikipedia:Chlormezanone Beilstein:23033 PMID:10191862 PMID:7104168 Drug_Central:603 CAS:80-77-3 PMID:29438107 |
|
definition |
A 1,3-thiazine that is 1,3-thiazinan-4-one S,S-dioxide in which a hydrogen at position 2 is substituted by a 4-chlorophenyl group and the hydrogen attached to the nitrogen is substituted by methyl. A non-benzodiazepine muscle relaxant, it was used in the management of anxiety and in the treatment of muscle spasms until being discontinued worldwide by its manufacturer in 1996, due to rare but serious cutaneous reactions. |
|
formula |
C11H12ClNO3S |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_51371 |
|
has_exact_synonym |
2-(4-chlorophenyl)-3-methyl-1,3-thiazinan-4-one 1,1-dioxide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
chlormethazanone 2-(p-chlorophenyl)tetrahydro-3-methyl-4H-1,3-thiazin-4-one 1,1-dioxide chlormezanona (+-)-chlormezanone chlormezanonum 2-(p-chlorphenyl)-3-methyl-1,3-perhydrothiazin-4-on-1,1-dioxide chlormezanone |
|
id |
CHEBI:3619 |
|
in_subset | ||
inchi |
InChI=1S/C11H12ClNO3S/c1-13-10(14)6-7-17(15,16)11(13)8-2-4-9(12)5-3-8/h2-5,11H,6-7H2,1H3 |
|
inchikey |
WEQAYVWKMWHEJO-UHFFFAOYSA-N |
|
label |
chlormezanone |
|
mass |
273.73600 |
|
monoisotopicmass |
273.02264 |
|
notation |
CHEBI:3619 |
|
prefLabel |
chlormezanone |
|
smiles |
CN1C(c2ccc(Cl)cc2)S(=O)(=O)CCC1=O |
|
treeView |
http://purl.obolibrary.org/obo/CHEBI_35850 http://purl.obolibrary.org/obo/CHEBI_83403 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35850 http://purl.obolibrary.org/obo/CHEBI_83403 |