loading...| Preferred Name |
diuron |
|
| Synonyms |
diuron 3-(3,4-dichlorophenyl)-1,1-dimethylurea N,N,-dimethyl-N'-(3,4-dichlorophenyl)urea 3-(3,4-Dichloro-phenyl)-1,1-dimethyl-urea 1-(3,4-dichlorophenyl)-3,3-dimethylurea DCMU N-(3,4-dichlorophenyl)-N',N'-dimethylurea N'-(3,4-dichlorophenyl)-N,N-dimethylurea 1-(3,4-dichlorophenyl)-3,3-dimethyluree 1,1-dimethyl-3-(3,4-dichlorophenyl)urea 3-(3,4-Dichlor-phenyl)-1,1-dimethyl-harnstoff |
|
| Definitions |
A member of the class of 3-(3,4-substituted-phenyl)-1,1-dimethylureas that is urea in which both of the hydrogens attached to one nitrogen are substituted by methyl groups, and one of the hydrogens attached to the other nitrogen is substituted by a 3,4-dichlorophenyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_116509 |
|
| charge |
0 |
|
| database_cross_reference |
MetaCyc:CPD-16775 PMID:17142046 KEGG:C18428 Patent:US2768971 PMID:17449247 Patent:CN103120180 LINCS:LSM-25609 Reaxys:2215168 PMID:23081760 PPDB:260 Wikipedia:Diuron Patent:CN103125511 Pesticides:diuron CAS:330-54-1 PMID:33400299 PMID:10866370 |
|
| definition |
A member of the class of 3-(3,4-substituted-phenyl)-1,1-dimethylureas that is urea in which both of the hydrogens attached to one nitrogen are substituted by methyl groups, and one of the hydrogens attached to the other nitrogen is substituted by a 3,4-dichlorophenyl group. |
|
| formula |
C9H10Cl2N2O |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_188147 http://purl.obolibrary.org/obo/CHEBI_26089 |
|
| has_exact_synonym |
diuron 3-(3,4-dichlorophenyl)-1,1-dimethylurea |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
N,N,-dimethyl-N'-(3,4-dichlorophenyl)urea 3-(3,4-Dichloro-phenyl)-1,1-dimethyl-urea 1-(3,4-dichlorophenyl)-3,3-dimethylurea DCMU N-(3,4-dichlorophenyl)-N',N'-dimethylurea N'-(3,4-dichlorophenyl)-N,N-dimethylurea 1-(3,4-dichlorophenyl)-3,3-dimethyluree 1,1-dimethyl-3-(3,4-dichlorophenyl)urea 3-(3,4-Dichlor-phenyl)-1,1-dimethyl-harnstoff |
|
| id |
CHEBI:116509 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H10Cl2N2O/c1-13(2)9(14)12-6-3-4-7(10)8(11)5-6/h3-5H,1-2H3,(H,12,14) |
|
| inchikey |
XMTQQYYKAHVGBJ-UHFFFAOYSA-N |
|
| label |
diuron |
|
| mass |
233.09500 |
|
| monoisotopicmass |
232.01702 |
|
| notation |
CHEBI:116509 |
|
| prefLabel |
diuron |
|
| smiles |
CN(C)C(=O)Nc1ccc(Cl)c(Cl)c1 |
|
| treeView | ||
| subClassOf |