loading...| Preferred Name |
trimethadione |
|
| Synonyms |
3,5,5-trimethyl-1,3-oxazolidine-2,4-dione Epidione Ptimal trimethadione 3,5,5-trimethyl-2,4-oxazolidinedione trimetadione Petimalin Epixal Absetil Tridione Dulcet Edion Petilep Petidion Absentol trimetadiona Convenixa trimethadionum Tridione |
|
| Definitions |
An oxazolidinone that is 1,3-oxazolidine-2,4-dione substituted by methyl groups at positions 3, 5 and 5. It is an antiepileptic agent. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_9727 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:16171802 PMID:9827046 PMID:18862627 PMID:13590839 LINCS:LSM-5345 Drug_Central:2751 PMID:8865369 KEGG:D00392 PMID:21638752 PMID:7653500 CAS:127-48-0 PMID:18248662 PMID:11722678 PMID:2210093 PMID:18876072 PMID:9375358 PMID:15282739 PMID:11057156 PMID:10634315 PMID:8791774 PMID:15653505 PMID:30605901 PMID:23017458 DrugBank:DB00347 PMID:13649111 Wikipedia:Trimethadione HMDB:HMDB0014491 Reaxys:121627 PMID:23321016 |
|
| definition |
An oxazolidinone that is 1,3-oxazolidine-2,4-dione substituted by methyl groups at positions 3, 5 and 5. It is an antiepileptic agent. |
|
| formula |
C6H9NO3 |
|
| has role | ||
| has_alternative_id |
CHEBI:94526 |
|
| has_exact_synonym |
3,5,5-trimethyl-1,3-oxazolidine-2,4-dione |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Epidione Ptimal trimethadione 3,5,5-trimethyl-2,4-oxazolidinedione trimetadione Petimalin Epixal Absetil Tridione Dulcet Edion Petilep Petidion Absentol trimetadiona Convenixa trimethadionum Tridione |
|
| id |
CHEBI:9727 |
|
| in_subset | ||
| inchi |
InChI=1S/C6H9NO3/c1-6(2)4(8)7(3)5(9)10-6/h1-3H3 |
|
| inchikey |
IRYJRGCIQBGHIV-UHFFFAOYSA-N |
|
| label |
trimethadione |
|
| mass |
143.142 |
|
| monoisotopicmass |
143.05824 |
|
| notation |
CHEBI:9727 |
|
| prefLabel |
trimethadione |
|
| smiles |
CN1C(=O)OC(C)(C)C1=O |
|
| treeView | ||
| subClassOf |