loading...| Preferred Name |
carbimazole |
|
| Synonyms |
Ethyl 3-methyl-2-thioimidazoline-1-carboxylate Carbinazole Thyrostat carbimazole carbimazolum Carbethoxymethimazole carbimazol Athyromazole ethyl 3-methyl-2-thioxo-2,3-dihydro-1H-imidazole-1-carboxylate |
|
| Definitions |
A member of the class of imidazoles that is methimazole in which the nitrogen bearing a hydrogen is converted into its ethoxycarbonyl derivative. A prodrug for methimazol, carbimazole is used for the treatment of hyperthyroidism. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_617099 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:23391946 KEGG:C07615 Drug_Central:497 Reaxys:144339 LINCS:LSM-5930 PMID:23900475 PMID:1502708 DrugBank:DB00389 Patent:US2671088 Patent:US2815349 PMID:18954039 PMID:25013255 PMID:24255992 KEGG:D07616 PMID:23776913 PMID:24049063 CAS:22232-54-8 VSDB:1876 Wikipedia:Carbimazole PMID:24265129 PMID:23343442 |
|
| definition |
A member of the class of imidazoles that is methimazole in which the nitrogen bearing a hydrogen is converted into its ethoxycarbonyl derivative. A prodrug for methimazol, carbimazole is used for the treatment of hyperthyroidism. |
|
| formula |
C7H10N2O2S |
|
| has role | ||
| has_alternative_id |
CHEBI:3397 |
|
| has_exact_synonym |
ethyl 3-methyl-2-thioxo-2,3-dihydro-1H-imidazole-1-carboxylate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Ethyl 3-methyl-2-thioimidazoline-1-carboxylate Carbinazole Thyrostat carbimazole carbimazolum Carbethoxymethimazole carbimazol Athyromazole |
|
| id |
CHEBI:617099 |
|
| in_subset | ||
| inchi |
InChI=1S/C7H10N2O2S/c1-3-11-7(10)9-5-4-8(2)6(9)12/h4-5H,3H2,1-2H3 |
|
| inchikey |
CFOYWRHIYXMDOT-UHFFFAOYSA-N |
|
| label |
carbimazole |
|
| mass |
186.23100 |
|
| monoisotopicmass |
186.04630 |
|
| notation |
CHEBI:617099 |
|
| prefLabel |
carbimazole |
|
| smiles |
CCOC(=O)n1ccn(C)c1=S |
|
| treeView | ||
| subClassOf |