Preferred Name |
curcumin |
|
Synonyms |
(1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione Curcumin curcumin Diferuloylmethane Turmeric yellow C.I. Natural Yellow 3 Kacha haldi Natural yellow 3 C.I. 75300 E 100 |
|
Definitions |
A beta-diketone that is methane in which two of the hydrogens are substituted by feruloyl groups. A natural dyestuff found in the root of Curcuma longa. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3962 |
|
charge |
0 |
|
definition |
A beta-diketone that is methane in which two of the hydrogens are substituted by feruloyl groups. A natural dyestuff found in the root of Curcuma longa. |
|
formula |
C21H20O6 |
|
hasDbXref |
PMID:16972983 PMID:34572491 PMID:14634121 PMID:34473340 Wikipedia:Curcumin PMID:19204190 PMID:23574161 Chemspider:839564 PMID:15753945 PMID:22753715 PMID:12450549 PMID:22122768 KNApSAcK:C00002731 PMID:19038979 PMID:34572272 PMID:14561543 PDBeChem:CC9 PMID:12826232 PMID:21642934 Reaxys:2306965 PMID:23386263 PMID:15879598 PMID:15842781 PMID:17182546 Patent:KR20130050834 PMID:19234767 PMID:15129424 PMID:22211691 PMID:15809436 DrugBank:DB11672 PMID:10923784 PMID:22044005 PMID:15659840 PMID:9698073 PMID:22118895 PMID:16712454 PMID:16413584 PMID:22051121 PMID:22318308 Patent:DE859145 CAS:458-37-7 PMID:12083767 PMID:34299604 KEGG:C10443 PMID:16276182 PMID:21466422 HMDB:HMDB0002269 PMID:20057137 LINCS:LSM-43083 MetaCyc:CPD-6602 PMID:16292655 PMID:18815282 PMID:20645870 |
|
hasExactSynonym |
(1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione Curcumin curcumin |
|
hasOBONamespace |
chebi_ontology |
|
hasRelatedSynonym |
Diferuloylmethane Turmeric yellow C.I. Natural Yellow 3 Kacha haldi Natural yellow 3 C.I. 75300 E 100 |
|
id |
CHEBI:3962 |
|
inchi |
InChI=1S/C21H20O6/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2/h3-12,24-25H,13H2,1-2H3/b7-3+,8-4+ |
|
inchikey |
VFLDPWHFBUODDF-FCXRPNKRSA-N |
|
inSubset | ||
label |
curcumin curcumin |
|
mass |
368.385 |
|
monoisotopicmass |
368.12599 |
|
notation |
CHEBI:3962 |
|
prefLabel |
curcumin |
|
smiles |
COC1=C(O)C=CC(\C=C\C(=O)CC(=O)\C=C\C2=CC(OC)=C(O)C=C2)=C1 |
|
subClassOf |