Preferred Name |
valine |
|
Synonyms |
valine 2-amino-3-methylbutanoic acid DL-valine Hval Valin valina |
|
Definitions |
A branched-chain amino acid that consists of glycine in which one of the hydrogens attached to the alpha-carbon is substituted by an isopropyl group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_27266 |
|
charge |
0 |
|
definition |
A branched-chain amino acid that consists of glycine in which one of the hydrogens attached to the alpha-carbon is substituted by an isopropyl group. |
|
formula |
C5H11NO2 |
|
hasDbXref |
Wikipedia:Valine CAS:516-06-3 Gmelin:49877 KEGG:C16436 PMID:17190852 Beilstein:506689 PMID:22770225 Reaxys:506689 |
|
hasExactSynonym |
valine |
|
hasOBONamespace |
chebi_ontology |
|
hasRelatedSynonym |
2-amino-3-methylbutanoic acid DL-valine Hval Valin valina |
|
id |
CHEBI:27266 |
|
inchi |
InChI=1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8) |
|
inchikey |
KZSNJWFQEVHDMF-UHFFFAOYSA-N |
|
inSubset | ||
label |
valine valine |
|
mass |
117.14638 |
|
monoisotopicmass |
117.07898 |
|
notation |
CHEBI:27266 |
|
prefLabel |
valine |
|
smiles |
CC(C)C(N)C(O)=O |
|
subClassOf |