Preferred Name |
hydroquinone |
|
Synonyms |
Hydroquinone benzene-1,4-diol hydroquinone 1,4-Dihydroxybenzene 1,4-Benzenediol p-Hydroquinone Benzene-1,4-diol p-Benzenediol 4-Hydroxyphenol p-hydroxyphenol Eldoquin Quinol |
|
Definitions |
A benzenediol comprising benzene core carrying two hydroxy substituents para to each other. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17594 |
|
charge |
0 |
|
definition |
A benzenediol comprising benzene core carrying two hydroxy substituents para to each other. |
|
formula |
C6H6O2 |
|
hasAlternativeId |
CHEBI:24645 CHEBI:14416 CHEBI:5793 |
|
hasDbXref |
KEGG:D00073 PMID:15618234 PMID:24858384 PMID:19148301 Wikipedia:Hydroquinone HMDB:HMDB0002434 MetaCyc:HYDROQUINONE PMID:1395635 Beilstein:605970 Drug_Central:3282 PMID:25586344 PMID:12213471 Reaxys:605970 KNApSAcK:C00002656 CAS:123-31-9 UM-BBD_compID:c0091 Gmelin:2742 PMID:24407054 KEGG:C00530 PMID:1899343 KEGG:C15603 PMID:11170505 PMID:15894107 PPDB:1503 |
|
hasExactSynonym |
Hydroquinone benzene-1,4-diol hydroquinone |
|
hasOBONamespace |
chebi_ontology |
|
hasRelatedSynonym |
1,4-Dihydroxybenzene 1,4-Benzenediol p-Hydroquinone Benzene-1,4-diol p-Benzenediol 4-Hydroxyphenol p-hydroxyphenol Eldoquin Quinol |
|
id |
CHEBI:17594 |
|
inchi |
InChI=1S/C6H6O2/c7-5-1-2-6(8)4-3-5/h1-4,7-8H |
|
inchikey |
QIGBRXMKCJKVMJ-UHFFFAOYSA-N |
|
inSubset | ||
label |
hydroquinone hydroquinone |
|
mass |
110.11064 |
|
monoisotopicmass |
110.03678 |
|
notation |
CHEBI:17594 |
|
prefLabel |
hydroquinone |
|
smiles |
Oc1ccc(O)cc1 |
|
subClassOf |