loading...| Preferred Name |
beta-cryptoxanthin |
|
| Synonyms |
cryptoxanthin β-cryptoxanthin beta-Cryptoxanthin (3R)-beta,beta-caroten-3-ol beta-cryptoxanthin |
|
| Definitions |
A carotenol that exhibits antioxidant activity. It has been isolated from fruits such as papaya and oranges. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_10362 |
|
| charge |
0 |
|
| definition |
A carotenol that exhibits antioxidant activity. It has been isolated from fruits such as papaya and oranges. |
|
| formula |
C40H56O |
|
| hasDbXref |
CAS:472-70-8 PMID:15386932 PMID:19703237 KNApSAcK:C00000920 KEGG:C08591 MetaCyc:CPD-7409 Wikipedia:Cryptoxanthin LIPID_MAPS_instance:LMPR01070269 Reaxys:2230123 HMDB:HMDB0033844 Beilstein:2230123 |
|
| hasExactSynonym |
beta-Cryptoxanthin (3R)-beta,beta-caroten-3-ol beta-cryptoxanthin |
|
| hasOBONamespace |
chebi_ontology |
|
| hasRelatedSynonym |
cryptoxanthin β-cryptoxanthin |
|
| id |
CHEBI:10362 |
|
| inchi |
InChI=1S/C40H56O/c1-30(18-13-20-32(3)23-25-37-34(5)22-15-27-39(37,7)8)16-11-12-17-31(2)19-14-21-33(4)24-26-38-35(6)28-36(41)29-40(38,9)10/h11-14,16-21,23-26,36,41H,15,22,27-29H2,1-10H3/b12-11+,18-13+,19-14+,25-23+,26-24+,30-16+,31-17+,32-20+,33-21+/t36-/m1/s1 |
|
| inchikey |
DMASLKHVQRHNES-FKKUPVFPSA-N |
|
| inSubset | ||
| label |
beta-cryptoxanthin |
|
| mass |
552.87204 |
|
| monoisotopicmass |
552.43312 |
|
| notation |
CHEBI:10362 |
|
| prefLabel |
beta-cryptoxanthin |
|
| smiles |
CC(\C=C\C=C(C)\C=C\C1=C(C)CCCC1(C)C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)C[C@@H](O)CC1(C)C |
|
| subClassOf |