Preferred Name |
leucine |
|
Synonyms |
|
|
ID |
http://purl.obolibrary.org/obo/CHEBI_25017 |
|
Definition |
A branched-chain amino acid that consists of glycine in which one of the hydrogens attached to the alpha-carbon is substituted by an isobutyl group. |
|
InChI |
InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9) |
|
InChIKey |
InChIKey=ROHFNLRQFUQHCH-UHFFFAOYSA-N |
|
label |
leucine |
|
prefixIRI |
obo2:CHEBI_25017 |
|
prefLabel |
leucine |
|
SMILES |
CC(C)CC(N)C(O)=O |
|
Synonym |
Leuzin Hleu C6H13NO2 L (+-)-Leucine DL-Leucine leucine (RS)-Leucine Leu 2-amino-4-methylpentanoic acid Leucin |
|
xref |
ChemIDplus:328-39-2 KEGG COMPOUND:C16439 Gmelin:50203 CiteXplore:17439666 Wikipedia:Leucine NIST Chemistry WebBook:328-39-2 Beilstein:636005 LIPID MAPS:LMFA01100048 Reaxys:636005 |
|
subClassOf |
Create mapping