Jump to:
loading...| Preferred Name |
phosphonic acid |
|
| Synonyms |
|
|
| Definitions |
A phosphorus oxoacid that has formula H3O3P. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_44976 |
|
| alternative term |
(HO)2HPO InChI=1S/H3O3P/c1-4(2)3/h4H,(H2,1,2,3) [H]OP([H])(=O)O[H] hydridodihydroxidooxidophosphorus dihydrogen hydridotrioxophosphate(2-) hydridotrioxophosphoric(2-) acid InChIKey=ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphonsaeure HPO(OH)2 H3O3P [PHO(OH)2] phosphonic acid H2PHO3 Phosphonic acid |
|
| definition |
A phosphorus oxoacid that has formula H3O3P. |
|
| is conjugate acid of | ||
| is tautomer of | ||
| label |
phosphonic acid |
|
| prefixIRI |
CHEBI:44976 |
|
| prefLabel |
phosphonic acid |
|
| subClassOf |
Create mapping