loading...| Preferred Name |
cefprozil |
|
| Synonyms |
|
|
| Definitions |
A semisynthetic, second-generation cephalosporin, with prop-1-enyl and (R)-2-amino-2-(4-hydroxyphenyl)acetamido groups at positions 3 and 7, respectively, of the cephem skeleton. It is used to treat bronchitis as well as ear, skin and other bacterial infections. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3506 |
|
| alternative term |
[H][C@]12SCC(C=CC)=C(N1C(=O)[C@@]2([H])NC(=O)[C@H](N)c1ccc(O)cc1)C(O)=O cefprozilum Cefprozil anhydrous (6R,7R)-7-{[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino}-8-oxo-3-(prop-1-en-1-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Cefprozil C18H19N3O5S cefprozilo InChI=1S/C18H19N3O5S/c1-2-3-10-8-27-17-13(16(24)21(17)14(10)18(25)26)20-15(23)12(19)9-4-6-11(22)7-5-9/h2-7,12-13,17,22H,8,19H2,1H3,(H,20,23)(H,25,26)/t12-,13-,17-/m1/s1 InChIKey=WDLWHQDACQUCJR-PBFPGSCMSA-N |
|
| definition |
A semisynthetic, second-generation cephalosporin, with prop-1-enyl and (R)-2-amino-2-(4-hydroxyphenyl)acetamido groups at positions 3 and 7, respectively, of the cephem skeleton. It is used to treat bronchitis as well as ear, skin and other bacterial infections. |
|
| has role | ||
| label |
cefprozil |
|
| prefixIRI |
CHEBI:3506 |
|
| prefLabel |
cefprozil |
|
| subClassOf |