Jump to:
loading...| Preferred Name |
isoamyl acetate |
|
| Synonyms |
|
|
| Definitions |
An acetate ester that has formula C7H14O2. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_31725 |
|
| alternative term |
isoamyl ethanoate amylacetic ester acetic acid, 3-methylbutyl ester InChI=1S/C7H14O2/c1-6(2)4-5-9-7(3)8/h6H,4-5H2,1-3H3 acetate de 3-methylbutyle isopentyl ethanoate 3-methyl-1-butanol acetate beta-methyl butyl acetate Isoamyl acetate 3-methyl-1-butyl acetate 3-methyl-but-1-yl acetate C7H14O2 Isoamylazetat i-amyl acetate Isoamylacetat acetic acid, isopentyl ester InChIKey=MLFHJEHSLIIPHL-UHFFFAOYSA-N CC(C)CCOC(C)=O 3-methylbutyl acetate CH3C(O)O(CH2)2CH(CH3)2 acetate d'isopentyle isopentyl acetate 3-methylbutyl ethanoate acetate d'isoamyle |
|
| definition |
An acetate ester that has formula C7H14O2. |
|
| has functional parent | ||
| label |
isoamyl acetate |
|
| prefixIRI |
CHEBI:31725 |
|
| prefLabel |
isoamyl acetate |
|
| subClassOf |
Create mapping