Preferred Name |
serine |
|
Synonyms |
|
|
Definitions |
An alpha-amino acid that has formula C3H7NO3. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17822 |
|
alternative term |
serine Serin InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7) NC(CO)C(O)=O InChIKey=MTCFGRXMJLQNBG-UHFFFAOYSA-N 2-Amino-3-hydroxypropionic acid C3H7NO3 3-Hydroxyalanine Serine 2-amino-3-hydroxypropanoic acid |
|
definition |
An alpha-amino acid that has formula C3H7NO3. |
|
has part | ||
is conjugate acid of | ||
is conjugate base of | ||
is tautomer of | ||
label |
serine |
|
prefixIRI |
CHEBI:17822 |
|
prefLabel |
serine |
|
subClassOf |
Create mapping