Preferred Name |
sulfonic acid |
|
Synonyms |
|
|
Definitions |
A sulfur oxoacid that has formula H2O3S. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_29214 |
|
alternative term |
[H]S(O)(=O)=O Sulfonsaeure [SHO2(OH)] acide sulfonique sulfonic acid sulphonic acid InChI=1S/H2O3S/c1-4(2)3/h4H,(H,1,2,3) InChIKey=BDHFUVZGWQCTTF-UHFFFAOYSA-N HSHO3 hydridohydroxidodioxidosulfur H2O3S |
|
definition |
A sulfur oxoacid that has formula H2O3S. |
|
is conjugate acid of | ||
is tautomer of | ||
label |
sulfonic acid |
|
prefixIRI |
CHEBI:29214 |
|
prefLabel |
sulfonic acid |
|
subClassOf |
Create mapping