Preferred Name |
aldosterone |
|
Synonyms |
|
|
Definitions |
A pregnane-based steroidal hormone produced by the outer-section (zona glomerulosa) of the adrenal cortex in the adrenal gland, and acts on the distal tubules and collecting ducts of the kidney to cause the conservation of sodium, secretion of potassium, increased water retention, and increased blood pressure. The overall effect of aldosterone is to increase reabsorption of ions and water in the kidney. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_27584 |
|
alternative term |
aldosterone (+)-aldosterone [H][C@@]1(CC[C@@]2([H])[C@]3([H])CCC4=CC(=O)CC[C@]4(C)[C@@]3([H])[C@@H](O)C[C@]12C=O)C(=O)CO C21H28O5 11beta,21-dihydroxy-3,20-dioxopregn-4-en-18-al InChIKey=PQSUYGKTWSAVDQ-ZVIOFETBSA-N InChI=1S/C21H28O5/c1-20-7-6-13(24)8-12(20)2-3-14-15-4-5-16(18(26)10-22)21(15,11-23)9-17(25)19(14)20/h8,11,14-17,19,22,25H,2-7,9-10H2,1H3/t14-,15-,16+,17-,19+,20-,21+/m0/s1 ALDOSTERONE 11beta,21-Dihydroxy-3,20-dioxo-4-pregnen-18-al Aldosterone (11beta)-11,21-dihydroxy-3,20-dioxopregn-4-en-18-al |
|
definition |
A pregnane-based steroidal hormone produced by the outer-section (zona glomerulosa) of the adrenal cortex in the adrenal gland, and acts on the distal tubules and collecting ducts of the kidney to cause the conservation of sodium, secretion of potassium, increased water retention, and increased blood pressure. The overall effect of aldosterone is to increase reabsorption of ions and water in the kidney. |
|
has parent hydride | ||
label |
aldosterone |
|
prefixIRI |
CHEBI:27584 |
|
prefLabel |
aldosterone |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_36885 http://purl.obolibrary.org/obo/CHEBI_47788 http://purl.obolibrary.org/obo/CHEBI_25354 http://purl.obolibrary.org/obo/CHEBI_26764 http://purl.obolibrary.org/obo/CHEBI_35344 http://purl.obolibrary.org/obo/CHEBI_61313 |