Jump to:
loading...| Preferred Name |
borate |
|
| Synonyms |
|
|
| Definitions |
A borate ion that has formula BO3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_22908 |
|
| alternative term |
[O-]B([O-])[O-] [BO3](3-) trioxidoborate(3-) BO3 InChI=1S/BO3/c2-1(3)4/q-3 trioxoborate(III) anion trioxoborate(3-) ion InChIKey=BTBUEUYNUDRHOZ-UHFFFAOYSA-N BO3(3-) (BO3)3- borate borate ion |
|
| definition |
A borate ion that has formula BO3. |
|
| is conjugate base of | ||
| label |
borate |
|
| prefixIRI |
CHEBI:22908 |
|
| prefLabel |
borate |
|
| subClassOf |
Create mapping