Preferred Name |
L-phenylalanine |
|
Synonyms |
|
|
Definitions |
The L-enantiomer of phenylalanine. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17295 |
|
alternative term |
C9H11NO2 L-phenylalanine L-Phenylalanine beta-phenyl-L-alanine 3-phenyl-L-alanine Phe (2S)-2-amino-3-phenylpropanoic acid (S)-alpha-Amino-beta-phenylpropionic acid InChIKey=COLNVLDHVKWLRT-QMMMGPOBSA-N InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1 F PHENYLALANINE N[C@@H](Cc1ccccc1)C(O)=O |
|
definition |
The L-enantiomer of phenylalanine. |
|
is conjugate acid of | ||
is conjugate base of | ||
is enantiomer of | ||
is tautomer of | ||
label |
L-phenylalanine |
|
prefixIRI |
CHEBI:17295 |
|
prefLabel |
L-phenylalanine |
|
subClassOf |
Create mapping