Preferred Name |
propionate |
|
Synonyms |
|
|
Definitions |
The conjugate base of propionic acid; a key precursor in lipid biosynthesis. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17272 |
|
alternative term |
C3H5O2 propanoic acid, ion(1-) propanoate InChIKey=XBDQKXXYIPTUBI-UHFFFAOYSA-M propionate methylacetate CH3-CH2-COO(-) ethylformate carboxylatoethane pseudoacetate InChI=1S/C3H6O2/c1-2-3(4)5/h2H2,1H3,(H,4,5)/p-1 EtCO2 anion metacetonate propanate ethanecarboxylate CCC([O-])=O |
|
definition |
The conjugate base of propionic acid; a key precursor in lipid biosynthesis. |
|
is conjugate base of | ||
label |
propionate |
|
prefixIRI |
CHEBI:17272 |
|
prefLabel |
propionate |
|
subClassOf |
Create mapping