Preferred Name |
Peginterferon Alfa-2a |
|
Synonyms |
|
|
Definitions |
A covalent conjugate of recombinant interferon alfa, subtype 2a, and polyethylene glycol (PEG), used as an antiviral and antineoplastic agent. The biological activity of this agent is derived from its interferon alpha-2a protein moiety. Interferons alfa bind to specific cell-surface receptors, leading to the transcription and translation of genes whose protein products mediate antiviral, antiproliferative, anticancer and immune-modulating effects. The PEG moiety lowers the clearance of interferon alpha-2a, thereby extending the duration of its therapeutic effects, but may also reduce interferon-mediated stimulation of an immune response. (NCI04) |
|
ID |
http://purl.obolibrary.org/obo/NCIT_C33987 |
|
Accepted_Therapeutic_Use_For |
Chronic hepatitis C; renal cell carcinoma; advanced melanoma; chronic myelogenous leukaemia |
|
ALT_DEFINITION |
A drug used to treat hepatitis C infections. It is also being studied in the treatment and prevention of cancer. It is a cytokine that is modified in the laboratory. It is a type of biological response modifier. |
|
CAS_Registry |
198153-51-4 |
|
Chemical_Formula |
C10H18N3O5(C2H4O)n(C2H4O)n |
|
code |
C33987 |
|
Contributing_Source |
CTRP FDA |
|
definition |
A covalent conjugate of recombinant interferon alfa, subtype 2a, and polyethylene glycol (PEG), used as an antiviral and antineoplastic agent. The biological activity of this agent is derived from its interferon alpha-2a protein moiety. Interferons alfa bind to specific cell-surface receptors, leading to the transcription and translation of genes whose protein products mediate antiviral, antiproliferative, anticancer and immune-modulating effects. The PEG moiety lowers the clearance of interferon alpha-2a, thereby extending the duration of its therapeutic effects, but may also reduce interferon-mediated stimulation of an immune response. (NCI04) |
|
Display_Name |
Peginterferon Alfa-2a |
|
FDA_UNII_Code |
Q46947FE7K |
|
in_subset |
http://purl.obolibrary.org/obo/NCIT_C63923 http://purl.obolibrary.org/obo/NCIT_C177537 http://purl.obolibrary.org/obo/NCIT_C176424 http://purl.obolibrary.org/obo/NCIT_C116977 http://purl.obolibrary.org/obo/NCIT_C116978 http://purl.obolibrary.org/obo/NCIT_C128784 |
|
Is_Value_For_GDC_Property | ||
label |
Peginterferon Alfa-2a |
|
Legacy Concept Name |
PEG-Interferon_Alfa-2a |
|
Maps_To |
Peginterferon Alfa-2a |
|
NCI_Drug_Dictionary_ID |
335280 |
|
NSC Number |
729130 |
|
PDQ_Closed_Trial_Search_ID |
335280 |
|
PDQ_Open_Trial_Search_ID |
335280 |
|
Preferred_Name |
Peginterferon Alfa-2a |
|
prefixIRI |
NCIT:C33987 |
|
prefLabel |
Peginterferon Alfa-2a |
|
Semantic_Type |
Amino Acid, Peptide, or Protein Pharmacologic Substance Immunologic Factor |
|
UMLS_CUI |
C0391001 |
|
subClassOf |