Preferred Name |
selenocysteine |
|
Synonyms |
2-amino-3-selanylpropanoic acid Selenocysteine 3-selenoalanine Selenozystein Selenocystein |
|
Definitions |
An alpha-amino acid that consists of alanine where one of the methyl hydrogens is substituted with a seleno group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_9093 |
|
charge |
0 |
|
database_cross_reference |
PMID:21856085 PMID:21213257 Reaxys:2498377 MetaCyc:CPD0-1561 PMID:21564332 DrugBank:DB02345 CAS:3614-08-2 Beilstein:2498377 |
|
definition |
An alpha-amino acid that consists of alanine where one of the methyl hydrogens is substituted with a seleno group. |
|
formula |
C3H7NO2Se |
|
has part | ||
has_exact_synonym |
2-amino-3-selanylpropanoic acid Selenocysteine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
3-selenoalanine Selenozystein Selenocystein |
|
id |
CHEBI:9093 |
|
in_subset | ||
inchi |
InChI=1S/C3H7NO2Se/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6) |
|
inchikey |
ZKZBPNGNEQAJSX-UHFFFAOYSA-N |
|
is_conjugate_acid_of | ||
is_conjugate_base_of | ||
label |
selenocysteine |
|
mass |
168.05322 |
|
monoisotopicmass |
168.96420 |
|
notation |
CHEBI:9093 |
|
prefLabel |
selenocysteine |
|
RO_0000087 | ||
smiles |
NC(C[SeH])C(O)=O |
|
subClassOf |