Preferred Name |
pentobarbital |
|
Synonyms |
Pentobarbital 5-ethyl-5-(pentan-2-yl)pyrimidine-2,4,6(1H,3H,5H)-trione 5-ethyl-5-(sec-pentyl)barbituric acid 5-Ethyl-5-(1-methyl-butyl)-pyrimidine-2,4,6-trione 5-ethyl-5-(1-methylbutyl)barbituric acid 5-Ethyl-5-(1-methylbutyl)-2,4,6(1H,3H,5H)-pyrimidinetrione Pentobarbitone Nembutal |
|
Definitions |
A member of the class of barbiturates, the structure of which is that of barbituric acid substituted at C-5 by ethyl and sec-pentyl groups. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_7983 |
|
charge |
0 |
|
database_cross_reference |
PMID:3599019 PMID:2215478 Wikipedia:Pentobarbital KEGG:C07422 PMID:9599235 PMID:9412440 Gmelin:281792 HMDB:HMDB0014457 PMID:19879734 LINCS:LSM-1566 PMID:6864729 PMID:2579237 PMID:7154009 PMID:16720246 PMID:1977910 PMID:15324906 Drug_Central:2095 PMID:23345614 PMID:23246494 Reaxys:87067 KEGG:D00499 PMID:15857133 DrugBank:DB00312 PMID:9016329 CAS:76-74-4 PMID:3654008 Beilstein:87067 PMID:15801854 PMID:23663566 PMID:23526799 VSDB:3000 |
|
definition |
A member of the class of barbiturates, the structure of which is that of barbituric acid substituted at C-5 by ethyl and sec-pentyl groups. |
|
formula |
C11H18N2O3 |
|
has_alternative_id |
CHEBI:102327 |
|
has_exact_synonym |
Pentobarbital 5-ethyl-5-(pentan-2-yl)pyrimidine-2,4,6(1H,3H,5H)-trione |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
5-ethyl-5-(sec-pentyl)barbituric acid 5-Ethyl-5-(1-methyl-butyl)-pyrimidine-2,4,6-trione 5-ethyl-5-(1-methylbutyl)barbituric acid 5-Ethyl-5-(1-methylbutyl)-2,4,6(1H,3H,5H)-pyrimidinetrione Pentobarbitone Nembutal |
|
id |
CHEBI:7983 |
|
in_subset | ||
inchi |
InChI=1S/C11H18N2O3/c1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15/h7H,4-6H2,1-3H3,(H2,12,13,14,15,16) |
|
inchikey |
WEXRUCMBJFQVBZ-UHFFFAOYSA-N |
|
label |
pentobarbital |
|
mass |
226.27230 |
|
monoisotopicmass |
226.13174 |
|
notation |
CHEBI:7983 |
|
prefLabel |
pentobarbital |
|
RO_0000087 | ||
smiles |
CCCC(C)C1(CC)C(=O)NC(=O)NC1=O |
|
subClassOf |