Preferred Name |
naproxen |
|
Synonyms |
(2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid Naproxen naproxen (+)-Naproxen (S)-Naproxen (S)-(+)-2-(6-Methoxy-2-naphthyl)propionic acid (+)-(S)-6-Methoxy-alpha-methyl-2-naphthaleneacetic acid (+)-(S)-Naproxen (S)-(+)-Naproxen (+)-2-(6-Methoxy-2-naphthyl)propionic acid (+)-2-(Methoxy-2-naphthyl)-propionsaeure (S)-6-Methoxy-alpha-methyl-2-naphthaleneacetic acid (S)-2-(6-Methoxy-2-naphthyl)propionic acid (+)-2-(Methoxy-2-naphthyl)-propionic acid (S)-2-(6-Methoxy-2-naphthyl)propanoic acid naproxene naproxeno naproxenum |
|
Definitions |
A methoxynaphthalene that is 2-methoxynaphthalene substituted by a carboxy ethyl group at position 6. Naproxen is a non-steroidal anti-inflammatory drug commonly used for the reduction of pain, fever, inflammation and stiffness caused by conditions such as osteoarthritis, kidney stones, rheumatoid arthritis, psoriatic arthritis, gout, ankylosing spondylitis, menstrual cramps, tendinitis, bursitis, and for the treatment of primary dysmenorrhea. It works by inhibiting both the COX-1 and COX-2 enzymes. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_7476 |
|
charge |
0 |
|
database_cross_reference |
PMID:18044350 DrugBank:DB00788 LINCS:LSM-5689 Patent:US4009197 Patent:US3904682 KEGG:D00118 PMID:24478225 HMDB:HMDB0001923 Drug_Central:1883 CAS:22204-53-1 Beilstein:3591067 Wikipedia:Naproxen PMID:9784154 |
|
definition |
A methoxynaphthalene that is 2-methoxynaphthalene substituted by a carboxy ethyl group at position 6. Naproxen is a non-steroidal anti-inflammatory drug commonly used for the reduction of pain, fever, inflammation and stiffness caused by conditions such as osteoarthritis, kidney stones, rheumatoid arthritis, psoriatic arthritis, gout, ankylosing spondylitis, menstrual cramps, tendinitis, bursitis, and for the treatment of primary dysmenorrhea. It works by inhibiting both the COX-1 and COX-2 enzymes. |
|
formula |
C14H14O3 |
|
has_alternative_id |
CHEBI:603695 |
|
has_exact_synonym |
(2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid Naproxen naproxen |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(+)-Naproxen (S)-Naproxen (S)-(+)-2-(6-Methoxy-2-naphthyl)propionic acid (+)-(S)-6-Methoxy-alpha-methyl-2-naphthaleneacetic acid (+)-(S)-Naproxen (S)-(+)-Naproxen (+)-2-(6-Methoxy-2-naphthyl)propionic acid (+)-2-(Methoxy-2-naphthyl)-propionsaeure (S)-6-Methoxy-alpha-methyl-2-naphthaleneacetic acid (S)-2-(6-Methoxy-2-naphthyl)propionic acid (+)-2-(Methoxy-2-naphthyl)-propionic acid (S)-2-(6-Methoxy-2-naphthyl)propanoic acid naproxen naproxene naproxeno naproxenum |
|
id |
CHEBI:7476 |
|
in_subset | ||
inchi |
InChI=1S/C14H14O3/c1-9(14(15)16)10-3-4-12-8-13(17-2)6-5-11(12)7-10/h3-9H,1-2H3,(H,15,16)/t9-/m0/s1 |
|
inchikey |
CMWTZPSULFXXJA-VIFPVBQESA-N |
|
is_conjugate_acid_of | ||
label |
naproxen |
|
mass |
230.25920 |
|
monoisotopicmass |
230.09429 |
|
notation |
CHEBI:7476 |
|
prefLabel |
naproxen |
|
RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_35493 http://purl.obolibrary.org/obo/CHEBI_35845 http://purl.obolibrary.org/obo/CHEBI_50629 http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_35475 http://purl.obolibrary.org/obo/CHEBI_88188 http://purl.obolibrary.org/obo/CHEBI_78298 |
|
smiles |
COc1ccc2cc(ccc2c1)[C@H](C)C(O)=O |
|
subClassOf |