Preferred Name |
deferiprone |
|
Synonyms |
3-hydroxy-1,2-dimethylpyridin-4(1H)-one 1,2-Dimethyl-3-hydroxypyrid-4-one 3-Hydroxy-1,2-dimethyl-4(1H)-pyridone deferiprone Ferriprox |
|
Definitions |
A member of the class of 4-pyridones that is pyridin-4(1H)-one substituted at positions 1 and 2 by methyl groups and at position 3 by a hydroxy group. A lipid-soluble iron-chelator used for treatment of thalassaemia. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_68554 |
|
charge |
0 |
|
database_cross_reference |
Drug_Central:4188 PMID:22572843 PMID:22468647 PMID:22180427 PMID:22459459 PMID:22130677 PMID:22454828 PMID:22565013 PMID:21853518 PMID:22034002 PMID:22621771 Reaxys:1447108 PMID:22277065 Beilstein:1447108 PMID:22850524 Wikipedia:Deferiprone PMID:22943064 LINCS:LSM-36972 PMID:22978744 PMID:22025507 CAS:30652-11-0 PMID:22579919 KEGG:D07416 PMID:22406440 PMID:22171759 PMID:22457166 PMID:22664119 PMID:22759897 PMID:22622672 PMID:22354281 |
|
definition |
A member of the class of 4-pyridones that is pyridin-4(1H)-one substituted at positions 1 and 2 by methyl groups and at position 3 by a hydroxy group. A lipid-soluble iron-chelator used for treatment of thalassaemia. |
|
formula |
C7H9NO2 |
|
has_exact_synonym |
3-hydroxy-1,2-dimethylpyridin-4(1H)-one |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
1,2-Dimethyl-3-hydroxypyrid-4-one 3-Hydroxy-1,2-dimethyl-4(1H)-pyridone deferiprone Ferriprox |
|
id |
CHEBI:68554 |
|
in_subset | ||
inchi |
InChI=1S/C7H9NO2/c1-5-7(10)6(9)3-4-8(5)2/h3-4,10H,1-2H3 |
|
inchikey |
TZXKOCQBRNJULO-UHFFFAOYSA-N |
|
label |
deferiprone |
|
mass |
139.15190 |
|
monoisotopicmass |
139.06333 |
|
notation |
CHEBI:68554 |
|
prefLabel |
deferiprone |
|
RO_0000087 | ||
smiles |
Cc1c(O)c(=O)ccn1C |
|
subClassOf |