Preferred Name |
flucytosine |
|
Synonyms |
4-amino-5-fluoropyrimidin-2(1H)-one 5-Fluorocytosine flucytosina flucytosine flucytosinum Ancobon (TN) 5-Fluorocystosine 5-FC Ancotil |
|
Definitions |
An organofluorine compound that is cytosine that is substituted at position 5 by a fluorine. A prodrug for the antifungal 5-fluorouracil, it is used for the treatment of systemic fungal infections. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_5100 |
|
charge |
0 |
|
database_cross_reference |
PMID:14871609 PMID:25649231 PMID:23576540 CAS:2022-85-7 KEGG:D00323 HMDB:HMDB0015231 PMID:26201447 PDBeChem:1LD Patent:US2945038 DrugBank:DB01099 Patent:US3040026 Drug_Central:1188 PMID:18731030 LINCS:LSM-5878 Patent:US2802005 PMID:28166217 PMID:11519290 Wikipedia:Flucytosine |
|
definition |
An organofluorine compound that is cytosine that is substituted at position 5 by a fluorine. A prodrug for the antifungal 5-fluorouracil, it is used for the treatment of systemic fungal infections. |
|
formula |
C4H4FN3O |
|
has_exact_synonym |
4-amino-5-fluoropyrimidin-2(1H)-one |
|
has_functional_parent | ||
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
5-Fluorocytosine flucytosina flucytosine flucytosinum Ancobon (TN) 5-Fluorocystosine 5-FC Ancotil |
|
id |
CHEBI:5100 |
|
in_subset | ||
inchi |
InChI=1S/C4H4FN3O/c5-2-1-7-4(9)8-3(2)6/h1H,(H3,6,7,8,9) |
|
inchikey |
XRECTZIEBJDKEO-UHFFFAOYSA-N |
|
label |
flucytosine |
|
mass |
129.09250 |
|
monoisotopicmass |
129.03384 |
|
notation |
CHEBI:5100 |
|
prefLabel |
flucytosine |
|
RO_0000087 | ||
smiles |
Nc1nc(=O)[nH]cc1F |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_87205 http://purl.obolibrary.org/obo/CHEBI_37143 http://purl.obolibrary.org/obo/CHEBI_38337 |