Preferred Name |
felbamate |
|
Synonyms |
2-phenylpropane-1,3-diyl dicarbamate Felbamate 2-phenyl-1,3-propanediol dicarbamate carbamic acid 2-phenyltrimethylene ester Carbamic acid 3-carbamoyloxy-2-phenyl-propyl ester felbamate felbamato felbamatum |
|
Definitions |
The bis(carbamate ester) of 2-phenylpropane-1,3-diol. An anticonvulsant, it is used in the treatment of epilepsy. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_4995 |
|
charge |
0 |
|
database_cross_reference |
Reaxys:3345236 LINCS:LSM-4232 PMID:12825948 KEGG:C07501 Patent:US2884444 CAS:25451-15-4 PMID:12873507 Drug_Central:1140 DrugBank:DB00949 KEGG:D00536 Wikipedia:Felbamate PMID:18311896 Patent:US4978680 |
|
definition |
The bis(carbamate ester) of 2-phenylpropane-1,3-diol. An anticonvulsant, it is used in the treatment of epilepsy. |
|
formula |
C11H14N2O4 |
|
has_alternative_id |
CHEBI:250451 |
|
has_exact_synonym |
2-phenylpropane-1,3-diyl dicarbamate Felbamate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
2-phenyl-1,3-propanediol dicarbamate carbamic acid 2-phenyltrimethylene ester Carbamic acid 3-carbamoyloxy-2-phenyl-propyl ester felbamate felbamato felbamatum |
|
id |
CHEBI:4995 |
|
in_subset | ||
inchi |
InChI=1S/C11H14N2O4/c12-10(14)16-6-9(7-17-11(13)15)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H2,12,14)(H2,13,15) |
|
inchikey |
WKGXYQFOCVYPAC-UHFFFAOYSA-N |
|
label |
felbamate |
|
mass |
238.23990 |
|
monoisotopicmass |
238.09536 |
|
notation |
CHEBI:4995 |
|
prefLabel |
felbamate |
|
RO_0000087 | ||
smiles |
NC(=O)OCC(COC(N)=O)c1ccccc1 |
|
subClassOf |