Preferred Name |
5-fluorouracil |
|
Synonyms |
5-fluorouracil 5-Fluorouracil 5-fluoropyrimidine-2,4(1H,3H)-dione 5-Fluoropyrimidine-2,4-dione fluorouracilum Fluorouracil fluorouracil fluorouracilo 5-Fluoracil 5-FU |
|
Definitions |
A nucleobase analogue that is uracil in which the hydrogen at position 5 is replaced by fluorine. It is an antineoplastic agent which acts as an antimetabolite - following conversion to the active deoxynucleotide, it inhibits DNA synthesis (by blocking the conversion of deoxyuridylic acid to thymidylic acid by the cellular enzyme thymidylate synthetase) and so slows tumour growth. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_46345 |
|
charge |
0 |
|
database_cross_reference |
DrugBank:DB00544 Wikipedia:Fluorouracil PMID:11356943 Drug_Central:26 HMDB:HMDB0014684 Beilstein:127172 LINCS:LSM-4261 CAS:51-21-8 KEGG:C07649 PMID:12520460 PMID:14769231 PMID:19023200 PDBeChem:URF KEGG:D00584 Reaxys:127172 |
|
definition |
A nucleobase analogue that is uracil in which the hydrogen at position 5 is replaced by fluorine. It is an antineoplastic agent which acts as an antimetabolite - following conversion to the active deoxynucleotide, it inhibits DNA synthesis (by blocking the conversion of deoxyuridylic acid to thymidylic acid by the cellular enzyme thymidylate synthetase) and so slows tumour growth. |
|
formula |
C4H3FN2O2 |
|
has_alternative_id |
CHEBI:46343 CHEBI:2054 |
|
has_exact_synonym |
5-fluorouracil 5-Fluorouracil 5-fluoropyrimidine-2,4(1H,3H)-dione |
|
has_functional_parent | ||
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
5-Fluoropyrimidine-2,4-dione fluorouracilum Fluorouracil fluorouracil fluorouracilo 5-Fluoracil 5-FU |
|
id |
CHEBI:46345 |
|
in_subset | ||
inchi |
InChI=1S/C4H3FN2O2/c5-2-1-6-4(9)7-3(2)8/h1H,(H2,6,7,8,9) |
|
inchikey |
GHASVSINZRGABV-UHFFFAOYSA-N |
|
label |
5-fluorouracil |
|
mass |
130.07730 |
|
monoisotopicmass |
130.01786 |
|
notation |
CHEBI:46345 |
|
prefLabel |
5-fluorouracil |
|
RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_35705 http://purl.obolibrary.org/obo/CHEBI_35610 http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_35221 |
|
smiles |
Fc1c[nH]c(=O)[nH]c1=O |
|
subClassOf |