Preferred Name |
diazoxide |
|
Synonyms |
7-chloro-3-methyl-2H-1,2,4-benzothiadiazine 1,1-dioxide Diazoxide Diazossido Eudemine diazoxide diazoxido diazoxidum |
|
Definitions |
A benzothiadiazine that is the S,S-dioxide of 2H-1,2,4-benzothiadiazine which is substituted at position 3 by a methyl group and at position 7 by chlorine. A peripheral vasodilator, it increases the concentration of glucose in the plasma and inhibits the secretion of insulin by the beta- cells of the pancreas. It is used orally in the management of intractable hypoglycaemia and intravenously in the management of hypertensive emergencies. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_4495 |
|
charge |
0 |
|
database_cross_reference |
Reaxys:523907 PMID:20828743 CAS:364-98-7 LINCS:LSM-3639 Patent:US2986573 HMDB:HMDB0015251 PMID:20950601 PMID:21693179 PMID:15319354 KEGG:C06949 Patent:DE723278 Wikipedia:Diazoxide PMID:18191077 PMID:12039709 DrugBank:DB01119 Patent:US3345365 PMID:22047130 Drug_Central:854 PMID:16777075 Beilstein:523907 PMID:11014217 PMID:29438107 PMID:16740260 PMID:21538163 KEGG:D00294 |
|
definition |
A benzothiadiazine that is the S,S-dioxide of 2H-1,2,4-benzothiadiazine which is substituted at position 3 by a methyl group and at position 7 by chlorine. A peripheral vasodilator, it increases the concentration of glucose in the plasma and inhibits the secretion of insulin by the beta- cells of the pancreas. It is used orally in the management of intractable hypoglycaemia and intravenously in the management of hypertensive emergencies. |
|
formula |
C8H7ClN2O2S |
|
has_alternative_id |
CHEBI:6046 |
|
has_exact_synonym |
7-chloro-3-methyl-2H-1,2,4-benzothiadiazine 1,1-dioxide Diazoxide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Diazossido Eudemine diazoxide diazoxido diazoxidum |
|
id |
CHEBI:4495 |
|
in_subset | ||
inchi |
InChI=1S/C8H7ClN2O2S/c1-5-10-7-3-2-6(9)4-8(7)14(12,13)11-5/h2-4H,1H3,(H,10,11) |
|
inchikey |
GDLBFKVLRPITMI-UHFFFAOYSA-N |
|
label |
diazoxide |
|
mass |
230.67100 |
|
monoisotopicmass |
229.99168 |
|
notation |
CHEBI:4495 |
|
prefLabel |
diazoxide |
|
RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_35498 http://purl.obolibrary.org/obo/CHEBI_35524 http://purl.obolibrary.org/obo/CHEBI_35620 http://purl.obolibrary.org/obo/CHEBI_35522 http://purl.obolibrary.org/obo/CHEBI_64338 http://purl.obolibrary.org/obo/CHEBI_38633 http://purl.obolibrary.org/obo/CHEBI_35674 |
|
smiles |
CC1=Nc2ccc(Cl)cc2S(=O)(=O)N1 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35850 |