loading...| Preferred Name |
acridine |
|
| Synonyms |
acridine 10-azaanthracene dibenzo[b,e]pyridine benzo[b]quinoline 2,3,5,6-dibenzopyridine 9-azaanthracene 2,3-benzoquinoline Akridin acrydine |
|
| Definitions |
A polycyclic heteroarene that is anthracene in which one of the central CH groups is replaced by a nitrogen atom. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_36420 |
|
| charge |
0 |
|
| database_cross_reference |
Gmelin:143403 Beilstein:120200 Wikipedia:Acridine Reaxys:120200 PMID:11924543 CAS:260-94-6 PMID:24416442 |
|
| definition |
A polycyclic heteroarene that is anthracene in which one of the central CH groups is replaced by a nitrogen atom. |
|
| formula |
C13H9N |
|
| has_exact_synonym |
acridine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
10-azaanthracene dibenzo[b,e]pyridine benzo[b]quinoline 2,3,5,6-dibenzopyridine 9-azaanthracene 2,3-benzoquinoline Akridin acrydine |
|
| id |
CHEBI:36420 |
|
| in_subset | ||
| inchi |
InChI=1S/C13H9N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-9H |
|
| inchikey |
DZBUGLKDJFMEHC-UHFFFAOYSA-N |
|
| label |
acridine |
|
| mass |
179.21730 |
|
| monoisotopicmass |
179.07350 |
|
| notation |
CHEBI:36420 |
|
| prefLabel |
acridine |
|
| RO_0000087 | ||
| smiles |
c1ccc2nc3ccccc3cc2c1 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_36416 |