loading...| Preferred Name |
diuron |
|
| Synonyms |
3-(3,4-dichlorophenyl)-1,1-dimethylurea diuron N-(3,4-dichlorophenyl)-N',N'-dimethylurea 1-(3,4-dichlorophenyl)-3,3-dimethyluree 1-(3,4-dichlorophenyl)-3,3-dimethylurea 1,1-dimethyl-3-(3,4-dichlorophenyl)urea 3-(3,4-Dichloro-phenyl)-1,1-dimethyl-urea 3-(3,4-Dichlor-phenyl)-1,1-dimethyl-harnstoff N,N,-dimethyl-N'-(3,4-dichlorophenyl)urea N'-(3,4-dichlorophenyl)-N,N-dimethylurea DCMU |
|
| Definitions |
A member of the class of 3-(3,4-substituted-phenyl)-1,1-dimethylureas that is urea in which both of the hydrogens attached to one nitrogen are substituted by methyl groups, and one of the hydrogens attached to the other nitrogen is substituted by a 3,4-dichlorophenyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_116509 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:33400299 Patent:CN103120180 Pesticides:diuron Wikipedia:Diuron MetaCyc:CPD-16775 LINCS:LSM-25609 Patent:US2768971 CAS:330-54-1 PMID:17142046 PMID:10866370 PMID:17449247 Reaxys:2215168 PMID:23081760 KEGG:C18428 Patent:CN103125511 PPDB:260 |
|
| definition |
A member of the class of 3-(3,4-substituted-phenyl)-1,1-dimethylureas that is urea in which both of the hydrogens attached to one nitrogen are substituted by methyl groups, and one of the hydrogens attached to the other nitrogen is substituted by a 3,4-dichlorophenyl group. |
|
| formula |
C9H10Cl2N2O |
|
| has_exact_synonym |
3-(3,4-dichlorophenyl)-1,1-dimethylurea diuron |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
N-(3,4-dichlorophenyl)-N',N'-dimethylurea 1-(3,4-dichlorophenyl)-3,3-dimethyluree 1-(3,4-dichlorophenyl)-3,3-dimethylurea 1,1-dimethyl-3-(3,4-dichlorophenyl)urea 3-(3,4-Dichloro-phenyl)-1,1-dimethyl-urea 3-(3,4-Dichlor-phenyl)-1,1-dimethyl-harnstoff N,N,-dimethyl-N'-(3,4-dichlorophenyl)urea N'-(3,4-dichlorophenyl)-N,N-dimethylurea DCMU |
|
| id |
CHEBI:116509 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H10Cl2N2O/c1-13(2)9(14)12-6-3-4-7(10)8(11)5-6/h3-5H,1-2H3,(H,12,14) |
|
| inchikey |
XMTQQYYKAHVGBJ-UHFFFAOYSA-N |
|
| label |
diuron |
|
| mass |
233.09500 |
|
| monoisotopicmass |
232.01702 |
|
| notation |
CHEBI:116509 |
|
| prefLabel |
diuron |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_26089 |
|
| smiles |
CN(C)C(=O)Nc1ccc(Cl)c(Cl)c1 |
|
| subClassOf |