Jump to:
loading...| Preferred Name | proline | |
| Synonyms |
pyrrolidine-2-carboxylic acid DL-Proline Hpro Prolin prolina proline |
|
| Definitions |
An alpha-amino acid that is pyrrolidine bearing a carboxy substituent at position 2. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_26271 |
|
| bearer of | ||
| charge |
0 |
|
| database_cross_reference |
PMID:21903295 PMID:21400017 Reaxys:80809 PMID:22280966 KEGG:C16435 Gmelin:26927 PMID:22264337 Wikipedia:Proline Beilstein:80809 PMID:22770225 PMID:16534801 CAS:609-36-9 |
|
| formula |
C5H9NO2 |
|
| has role | ||
| has_exact_synonym |
proline |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
pyrrolidine-2-carboxylic acid DL-Proline Hpro Prolin prolina |
|
| id |
CHEBI:26271 |
|
| in_subset | ||
| inchi |
InChI=1S/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4,6H,1-3H2,(H,7,8) |
|
| inchikey |
ONIBWKKTOPOVIA-UHFFFAOYSA-N |
|
| is_conjugate_acid_of | ||
| is_conjugate_base_of | ||
| label |
proline |
|
| mass |
115.13050 |
|
| monoisotopicmass |
115.06333 |
|
| notation |
CHEBI:26271 |
|
| prefLabel |
proline |
|
| smiles |
OC(=O)C1CCCN1 |
|
| textual definition |
An alpha-amino acid that is pyrrolidine bearing a carboxy substituent at position 2. |
|
| subClassOf |
Create mapping