Preferred Name |
glutamate(2-) |
|
Synonyms |
glutamic acid dianion glutamate(2-) 2-aminopentanedioate glutamate |
|
Definitions |
A dicarboxylic acid dianion that is the conjugate base of glutamate(1-). |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_29987 |
|
charge |
-2 |
|
database_cross_reference |
Beilstein:4134100 Gmelin:327903 Reaxys:4134100 |
|
definition |
A dicarboxylic acid dianion that is the conjugate base of glutamate(1-). |
|
formula |
C5H7NO4 |
|
has characteristic | ||
has role | ||
has_exact_synonym |
glutamate(2-) 2-aminopentanedioate glutamate |
|
has_related_synonym |
glutamic acid dianion |
|
hasOBONamespace |
chebi_ontology |
|
id |
CHEBI:29987 |
|
inchi |
InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/p-2 |
|
inchikey |
WHUUTDBJXJRKMK-UHFFFAOYSA-L |
|
inSubset | ||
is_conjugate_base_of | ||
label |
glutamate(2-) |
|
mass |
145.11342 |
|
monoisotopicmass |
145.03860 |
|
notation |
CHEBI:29987 |
|
prefLabel |
glutamate(2-) |
|
smiles |
NC(CCC([O-])=O)C([O-])=O |
|
subClassOf |
Create mapping