Preferred Name | tyrosine | |
Synonyms |
2-amino-3-(4-hydroxyphenyl)propanoic acid 2-Amino-3-(p-hydroxyphenyl)propionic acid 3-(p-Hydroxyphenyl)alanine Tyr Tyrosin Y tirosina Tyrosine tyrosine |
|
Definitions |
An alpha-amino acid that is phenylalanine bearing a hydroxy substituent at position 4 on the phenyl ring. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_18186 |
|
charge |
0 |
|
database_cross_reference |
CAS:55520-40-6 KEGG:C01536 Beilstein:515881 Gmelin:27744 PMID:17190852 Reaxys:515881 CAS:556-03-6 KNApSAcK:C00001397 |
|
definition |
An alpha-amino acid that is phenylalanine bearing a hydroxy substituent at position 4 on the phenyl ring. |
|
formula |
C9H11NO3 |
|
has characteristic | ||
has part | ||
has role | ||
has_exact_synonym |
Tyrosine tyrosine |
|
has_functional_parent | ||
has_related_synonym |
2-amino-3-(4-hydroxyphenyl)propanoic acid 2-Amino-3-(p-hydroxyphenyl)propionic acid 3-(p-Hydroxyphenyl)alanine Tyr Tyrosin Y tirosina |
|
hasAlternativeId |
CHEBI:15277 CHEBI:27176 CHEBI:9800 |
|
hasOBONamespace |
chebi_ontology |
|
id |
CHEBI:18186 |
|
inchi |
InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13) |
|
inchikey |
OUYCCCASQSFEME-UHFFFAOYSA-N |
|
inSubset | ||
is_conjugate_acid_of | ||
is_conjugate_base_of | ||
label |
tyrosine |
|
mass |
181.18858 |
|
monoisotopicmass |
181.07389 |
|
notation |
CHEBI:18186 |
|
overlaps | ||
prefLabel |
tyrosine |
|
smiles |
NC(Cc1ccc(O)cc1)C(O)=O |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_33856 |