loading...| Preferred Name | benzoate | |
| Synonyms |
C7H5O2 Benzenemethanoate Benzeneformate 121.11340 Benzenecarboxylate benzoate anion InChI=1S/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9)/p-1 WPYMKLBDIGXBTP-UHFFFAOYSA-M Phenylformate Phenylcarboxylate [O-]C(=O)c1ccccc1 benzoic acid, ion(1-) benzoate |
|
| Definitions |
The simplest member of the class of benzoates that is the conjugate base of benzoic acid, comprising a benzoic acid core with a proton missing to give a charge of -1. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16150 |
|
| database_cross_reference |
Gmelin:2945 HMDB:HMDB01870 Reaxys:1862486 CAS:766-76-7 MetaCyc:BENZOATE Beilstein:1862486 UM-BBD_compID:c0121 KEGG:C00180 |
|
| definition |
The simplest member of the class of benzoates that is the conjugate base of benzoic acid, comprising a benzoic acid core with a proton missing to give a charge of -1. |
|
| has role | ||
| has_alternative_id |
CHEBI:13879 CHEBI:22717 |
|
| has_exact_synonym |
benzoate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
C7H5O2 Benzenemethanoate Benzeneformate 121.11340 Benzenecarboxylate benzoate anion InChI=1S/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9)/p-1 WPYMKLBDIGXBTP-UHFFFAOYSA-M Phenylformate Phenylcarboxylate [O-]C(=O)c1ccccc1 benzoic acid, ion(1-) |
|
| id |
CHEBI:16150 |
|
| imported from | ||
| is conjugate base of | ||
| label |
benzoate |
|
| notation |
CHEBI:16150 |
|
| prefLabel |
benzoate |
|
| subClassOf |