Preferred Name |
proline |
|
Synonyms |
|
|
Definitions |
An alpha-amino acid that is pyrrolidine bearing a carboxy substituent at position 2. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_26271 |
|
charge |
0 |
|
definition |
An alpha-amino acid that is pyrrolidine bearing a carboxy substituent at position 2. |
|
formula |
C5H9NO2 |
|
has characteristic | ||
has role | ||
inchi |
InChI=1S/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4,6H,1-3H2,(H,7,8) |
|
inchikey |
ONIBWKKTOPOVIA-UHFFFAOYSA-N |
|
is_conjugate_acid_of | ||
is_conjugate_base_of | ||
label |
proline |
|
mass |
115.13050 |
|
monoisotopicmass |
115.06333 |
|
prefixIRI |
CHEBI:26271 |
|
prefLabel |
proline |
|
smiles |
OC(=O)C1CCCN1 |
|
subClassOf |
Create mapping