Preferred Name |
alanine |
|
Synonyms |
|
|
Definitions |
An alpha-amino acid that consists of propionic acid bearing an amino substituent at position 2. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16449 |
|
charge |
0 |
|
definition |
An alpha-amino acid that consists of propionic acid bearing an amino substituent at position 2. |
|
formula |
C3H7NO2 |
|
has role | ||
has_functional_parent | ||
inchi |
InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6) |
|
inchikey |
QNAYBMKLOCPYGJ-UHFFFAOYSA-N |
|
is_conjugate_acid_of | ||
is_conjugate_base_of | ||
is_tautomer_of | ||
label |
alanine |
|
mass |
89.09322 |
|
monoisotopicmass |
89.04768 |
|
prefixIRI |
CHEBI:16449 |
|
prefLabel |
alanine |
|
smiles |
CC(N)C(O)=O |
|
subClassOf |
Create mapping