loading...| Preferred Name | acridine | |
| Synonyms |
dibenzo[b,e]pyridine benzo[b]quinoline acrydine 10-azaanthracene 2,3,5,6-dibenzopyridine 2,3-benzoquinoline Akridin 9-azaanthracene acridine |
|
| Definitions |
A polycyclic heteroarene that is anthracene in which one of the central CH groups is replaced by a nitrogen atom. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_36420 |
|
| alternative label |
dibenzo[b,e]pyridine benzo[b]quinoline acrydine 10-azaanthracene 2,3,5,6-dibenzopyridine 2,3-benzoquinoline Akridin 9-azaanthracene acridine |
|
| charge |
0 |
|
| database_cross_reference |
Beilstein:120200 CAS:260-94-6 PMID:24416442 Gmelin:143403 PMID:11924543 Wikipedia:Acridine Reaxys:120200 |
|
| definition |
A polycyclic heteroarene that is anthracene in which one of the central CH groups is replaced by a nitrogen atom. |
|
| formula |
C13H9N |
|
| has characteristic | ||
| has exact synonym |
acridine |
|
| has role | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
dibenzo[b,e]pyridine benzo[b]quinoline acrydine 10-azaanthracene 2,3,5,6-dibenzopyridine 2,3-benzoquinoline Akridin 9-azaanthracene |
|
| id |
CHEBI:36420 |
|
| in_subset | ||
| inchi |
InChI=1S/C13H9N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-9H |
|
| inchikey |
DZBUGLKDJFMEHC-UHFFFAOYSA-N |
|
| label |
acridine |
|
| mass |
179.21730 |
|
| monoisotopicmass |
179.07350 |
|
| notation |
CHEBI:36420 |
|
| note |
A polycyclic heteroarene that is anthracene in which one of the central CH groups is replaced by a nitrogen atom. |
|
| preferred label |
acridine |
|
| prefLabel |
acridine |
|
| smiles |
c1ccc2nc3ccccc3cc2c1 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_36416 |